C17H16N2O4S — CID 23250514
4-[2-(benzenesulfonyl)-1-phenylethyl]pyrazolidine-3,5-dione (PubChem CID 23250514) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-[2-(benzenesulfonyl)-1-phenylethyl]pyrazolidine-3,5-dione.
| Compound Name | 4-[2-(benzenesulfonyl)-1-phenylethyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 23250514 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-[2-(benzenesulfonyl)-1-phenylethyl]pyrazolidine-3,5-dione |
| SMILES | O=C1NNC(=O)C1C(CS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O4S/c20-16-15(17(21)19-18-16)14(12-7-3-1-4-8-12)11-24(22,23)13-9-5-2-6-10-13/h1-10,14-15H,11H2,(H,18,20)(H,19,21) |
| InChIKey | AOMRNTMAXXQKJB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|