C12H14O5S — CID 138968945
(4R)-4-[2-(benzenesulfonyl)ethyl]-5-methyl-1,3-dioxolan-2-one (PubChem CID 138968945) has the molecular formula C12H14O5S and a molecular weight of 270.31 g/mol. Its IUPAC name is (4R)-4-[2-(benzenesulfonyl)ethyl]-5-methyl-1,3-dioxolan-2-one.
| Compound Name | (4R)-4-[2-(benzenesulfonyl)ethyl]-5-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 138968945 |
| Molecular Formula | C12H14O5S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (4R)-4-[2-(benzenesulfonyl)ethyl]-5-methyl-1,3-dioxolan-2-one |
| SMILES | CC1OC(=O)O[C@@H]1CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O5S/c1-9-11(17-12(13)16-9)7-8-18(14,15)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9?,11-/m1/s1 |
| InChIKey | WDWJOQUFGWFPBD-HCCKASOXSA-N |
| XLogP | 1.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |