About 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene
2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene (PubChem CID 102356651) has the molecular formula C18H28O4S
and a molecular weight of 340.48 g/mol. Its IUPAC name is 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene.
Molecular Properties
| Compound Name | 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene |
| PubChem CID | 102356651 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene |
| SMILES | COCC1(COC)C[C@H](CCS(=O)(=O)c2ccccc2)[C@@H](C)C1 |
| InChI | InChI=1S/C18H28O4S/c1-15-11-18(13-21-2,14-22-3)12-16(15)9-10-23(19,20)17-7-5-4-6-8-17/h4-8,15-16H,9-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | HXGXQGJBGVCPIA-HOTGVXAUSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene?
The IUPAC name of 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene (CID 102356651) is 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene.
What is the SMILES notation for 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene?
The canonical SMILES for 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene is COCC1(COC)C[C@H](CCS(=O)(=O)c2ccccc2)[C@@H](C)C1.
What is the InChIKey of 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene?
The InChIKey is HXGXQGJBGVCPIA-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H28O4S/c1-15-11-18(13-21-2,14-22-3)12-16(15)9-10-23(19,20)17-7-5-4-6-8-17/h4-8,15-16H,9-14H2,1-3H3/t15-,16-/m0/s1.
What are the key properties of 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene?
2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene has a molecular weight of 340.48 g/mol, XLogP of 3.18, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]ethylsulfonylbenzene is sourced from PubChem (CID 102356651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).