C15H22O3S — CID 10802875
(4-methoxy-1,2-dimethylcyclopentyl)methylsulfonylbenzene (PubChem CID 10802875) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (4-methoxy-1,2-dimethylcyclopentyl)methylsulfonylbenzene.
| Compound Name | (4-methoxy-1,2-dimethylcyclopentyl)methylsulfonylbenzene |
|---|---|
| PubChem CID | 10802875 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (4-methoxy-1,2-dimethylcyclopentyl)methylsulfonylbenzene |
| SMILES | COC1CC(C)C(C)(CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H22O3S/c1-12-9-13(18-3)10-15(12,2)11-19(16,17)14-7-5-4-6-8-14/h4-8,12-13H,9-11H2,1-3H3 |
| InChIKey | PIJDBFYWUUCNLY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |