C28H30O6S2 — CID 98557348
(1R,2R,4R,5R,7S,8S,10R,11S)-6,14-bis[2-(benzenesulfonyl)ethyl]-3,9-dioxahexacyclo[9.2.1.02,4.05,13.07,12.08,10]tetradecane (PubChem CID 98557348) has the molecular formula C28H30O6S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is (1R,2R,4R,5R,7S,8S,10R,11S)-6,14-bis[2-(benzenesulfonyl)ethyl]-3,9-dioxahexacyclo[9.2.1.02,4.05,13.07,12.08,10]tetradecane.
| Compound Name | (1R,2R,4R,5R,7S,8S,10R,11S)-6,14-bis[2-(benzenesulfonyl)ethyl]-3,9-dioxahexacyclo[9.2.1.02,4.05,13.07,12.08,10]tetradecane |
|---|---|
| PubChem CID | 98557348 |
| Molecular Formula | C28H30O6S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | (1R,2R,4R,5R,7S,8S,10R,11S)-6,14-bis[2-(benzenesulfonyl)ethyl]-3,9-dioxahexacyclo[9.2.1.02,4.05,13.07,12.08,10]tetradecane |
| SMILES | O=S(=O)(CCC1[C@@H]2C3C4[C@H]1[C@H]1O[C@H]1[C@H]4C(CCS(=O)(=O)c1ccccc1)[C@H]3[C@H]1O[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C28H30O6S2/c29-35(30,15-7-3-1-4-8-15)13-11-17-19-23-21(27-25(19)33-27)18(22-24(23)20(17)26-28(22)34-26)12-14-36(31,32)16-9-5-2-6-10-16/h1-10,17-28H,11-14H2/t17?,18?,19-,20+,21-,22+,23?,24?,25-,26-,27-,28+/m1/s1 |
| InChIKey | RDAHWXUZEXQKRR-QGBXFKMASA-N |
| XLogP | 3.23 |
| TPSA | 93.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|