C27H32N2O4 — CID 25053235
tert-butyl N-[(1S,2R)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)but-3-enyl]cyclopropyl]carbamate (PubChem CID 25053235) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)but-3-enyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)but-3-enyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 25053235 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)but-3-enyl]cyclopropyl]carbamate |
| SMILES | C=C[C@H](C[C@H]1C[C@@H]1NC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H32N2O4/c1-5-18(14-17-15-24(17)29-26(31)33-27(2,3)4)28-25(30)32-16-23-21-12-8-6-10-19(21)20-11-7-9-13-22(20)23/h5-13,17-18,23-24H,1,14-16H2,2-4H3,(H,28,30)(H,29,31)/t17-,18+,24-/m0/s1 |
| InChIKey | HWOTTWDQYUKPCN-RHGYRFJNSA-N |
| XLogP | 5.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|