C29H37N3O4S — CID 59676992
tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamothioyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]carbamate (PubChem CID 59676992) has the molecular formula C29H37N3O4S and a molecular weight of 523.70 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamothioyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamothioyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59676992 |
| Molecular Formula | C29H37N3O4S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamothioyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]carbamate |
| SMILES | CN(C)C(=S)[C@H]1CC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H37N3O4S/c1-29(2,3)36-28(34)31-25-16-18(26(37)32(4)5)14-15-24(25)30-27(33)35-17-23-21-12-8-6-10-19(21)20-11-7-9-13-22(20)23/h6-13,18,23-25H,14-17H2,1-5H3,(H,30,33)(H,31,34)/t18-,24-,25+/m0/s1 |
| InChIKey | PXQZRDNIJQONPF-RIEVBORMSA-N |
| XLogP | 5.48 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|