C21H17N3O3 — CID 25055614
4-[(10S)-4-methoxy-12-oxo-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-10-yl]benzonitrile (PubChem CID 25055614) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 4-[(10S)-4-methoxy-12-oxo-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-10-yl]benzonitrile.
| Compound Name | 4-[(10S)-4-methoxy-12-oxo-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-10-yl]benzonitrile |
|---|---|
| PubChem CID | 25055614 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[(10S)-4-methoxy-12-oxo-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-10-yl]benzonitrile |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1COC(=O)N1[C@H]3c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H17N3O3/c1-26-15-6-7-18-16(9-15)17-8-14-11-27-21(25)24(14)20(19(17)23-18)13-4-2-12(10-22)3-5-13/h2-7,9,14,20,23H,8,11H2,1H3/t14?,20-/m0/s1 |
| InChIKey | OJBKNRJCQWJQLL-LGTGAQBVSA-N |
| XLogP | 3.51 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|