C21H19FN2O5 — CID 6712206
(15S)-4-fluoro-10-(4-hydroxy-3,5-dimethoxyphenyl)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-12-one (PubChem CID 6712206) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is (15S)-4-fluoro-10-(4-hydroxy-3,5-dimethoxyphenyl)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-12-one.
| Compound Name | (15S)-4-fluoro-10-(4-hydroxy-3,5-dimethoxyphenyl)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-12-one |
|---|---|
| PubChem CID | 6712206 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (15S)-4-fluoro-10-(4-hydroxy-3,5-dimethoxyphenyl)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-12-one |
| SMILES | COc1cc(C2c3[nH]c4ccc(F)cc4c3C[C@H]3COC(=O)N23)cc(OC)c1O |
| InChI | InChI=1S/C21H19FN2O5/c1-27-16-5-10(6-17(28-2)20(16)25)19-18-14(8-12-9-29-21(26)24(12)19)13-7-11(22)3-4-15(13)23-18/h3-7,12,19,23,25H,8-9H2,1-2H3/t12-,19?/m0/s1 |
| InChIKey | VHFRHIVDBVWKMA-HSLMYDHPSA-N |
| XLogP | 3.50 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|