C28H30N6O3 — CID 25056021
tert-butyl N-[6-[dipyridin-3-ylmethyl-(6-ethoxy-3-pyridinyl)amino]-3-pyridinyl]carbamate (PubChem CID 25056021) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is tert-butyl N-[6-[dipyridin-3-ylmethyl-(6-ethoxy-3-pyridinyl)amino]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[dipyridin-3-ylmethyl-(6-ethoxy-3-pyridinyl)amino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 25056021 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | tert-butyl N-[6-[dipyridin-3-ylmethyl-(6-ethoxy-3-pyridinyl)amino]-3-pyridinyl]carbamate |
| SMILES | CCOc1ccc(N(c2ccc(NC(=O)OC(C)(C)C)cn2)C(c2cccnc2)c2cccnc2)cn1 |
| InChI | InChI=1S/C28H30N6O3/c1-5-36-25-13-11-23(19-32-25)34(24-12-10-22(18-31-24)33-27(35)37-28(2,3)4)26(20-8-6-14-29-16-20)21-9-7-15-30-17-21/h6-19,26H,5H2,1-4H3,(H,33,35) |
| InChIKey | RGEXOIGNQFOCJW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |