C27H27N5O2 — CID 25053938
tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)anilino]-2-pyridinyl]carbamate (PubChem CID 25053938) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)anilino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)anilino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 25053938 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | tert-butyl N-[6-[N-(dipyridin-3-ylmethyl)anilino]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(N(c2ccccc2)C(c2cccnc2)c2cccnc2)n1 |
| InChI | InChI=1S/C27H27N5O2/c1-27(2,3)34-26(33)31-23-14-7-15-24(30-23)32(22-12-5-4-6-13-22)25(20-10-8-16-28-18-20)21-11-9-17-29-19-21/h4-19,25H,1-3H3,(H,30,31,33) |
| InChIKey | RTGRXYTWBBQSSK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |