C16H24N4O3 — CID 118116622
tert-butyl N-[6-[methyl-[2-(prop-2-enoylamino)ethyl]amino]-2-pyridinyl]carbamate (PubChem CID 118116622) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is tert-butyl N-[6-[methyl-[2-(prop-2-enoylamino)ethyl]amino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[methyl-[2-(prop-2-enoylamino)ethyl]amino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118116622 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | tert-butyl N-[6-[methyl-[2-(prop-2-enoylamino)ethyl]amino]-2-pyridinyl]carbamate |
| SMILES | C=CC(=O)NCCN(C)c1cccc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C16H24N4O3/c1-6-14(21)17-10-11-20(5)13-9-7-8-12(18-13)19-15(22)23-16(2,3)4/h6-9H,1,10-11H2,2-5H3,(H,17,21)(H,18,19,22) |
| InChIKey | NFBIWDRXUAIBDB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|