C20H22ClF3N4O4S2 — CID 25057657
3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(4-sulfamoylphenyl)-1,3-thiazolidine-2-carboxamide;hydrochloride (PubChem CID 25057657) has the molecular formula C20H22ClF3N4O4S2 and a molecular weight of 539.00 g/mol. Its IUPAC name is 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(4-sulfamoylphenyl)-1,3-thiazolidine-2-carboxamide;hydrochloride.
| Compound Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(4-sulfamoylphenyl)-1,3-thiazolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 25057657 |
| Molecular Formula | C20H22ClF3N4O4S2 |
| Molecular Weight | 539.00 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 3-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(4-sulfamoylphenyl)-1,3-thiazolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCSC1C(=O)Nc1ccc(S(N)(=O)=O)cc1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H21F3N4O4S2.ClH/c21-15-10-17(23)16(22)8-11(15)7-12(24)9-18(28)27-5-6-32-20(27)19(29)26-13-1-3-14(4-2-13)33(25,30)31;/h1-4,8,10,12,20H,5-7,9,24H2,(H,26,29)(H2,25,30,31);1H/t12-,20?;/m1./s1 |
| InChIKey | KFVBZXLPEOHOIS-IRYQMJBDSA-N |
| XLogP | 1.97 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.00 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|