C22H13N5O2 — CID 25061865
4-cyano-N-[4-(6-cyano-1-hydroxybenzimidazol-2-yl)phenyl]benzamide (PubChem CID 25061865) has the molecular formula C22H13N5O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-cyano-N-[4-(6-cyano-1-hydroxybenzimidazol-2-yl)phenyl]benzamide.
| Compound Name | 4-cyano-N-[4-(6-cyano-1-hydroxybenzimidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 25061865 |
| Molecular Formula | C22H13N5O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-cyano-N-[4-(6-cyano-1-hydroxybenzimidazol-2-yl)phenyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(-c3nc4ccc(C#N)cc4n3O)cc2)cc1 |
| InChI | InChI=1S/C22H13N5O2/c23-12-14-1-4-17(5-2-14)22(28)25-18-8-6-16(7-9-18)21-26-19-10-3-15(13-24)11-20(19)27(21)29/h1-11,29H,(H,25,28) |
| InChIKey | QZYFCWQLZMOBPC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|