C23H22N4O2 — CID 11668165
4-(dimethylamino)-N-[4-(1-hydroxy-5-methylbenzimidazol-2-yl)phenyl]benzamide (PubChem CID 11668165) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[4-(1-hydroxy-5-methylbenzimidazol-2-yl)phenyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[4-(1-hydroxy-5-methylbenzimidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 11668165 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-(dimethylamino)-N-[4-(1-hydroxy-5-methylbenzimidazol-2-yl)phenyl]benzamide |
| SMILES | Cc1ccc2c(c1)nc(-c1ccc(NC(=O)c3ccc(N(C)C)cc3)cc1)n2O |
| InChI | InChI=1S/C23H22N4O2/c1-15-4-13-21-20(14-15)25-22(27(21)29)16-5-9-18(10-6-16)24-23(28)17-7-11-19(12-8-17)26(2)3/h4-14,29H,1-3H3,(H,24,28) |
| InChIKey | OHGSVOZBHPLNDF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|