C14H20BrN7O — CID 25062249
7-bromo-3-[(dimethylamino)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one (PubChem CID 25062249) has the molecular formula C14H20BrN7O and a molecular weight of 382.27 g/mol. Its IUPAC name is 7-bromo-3-[(dimethylamino)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one.
| Compound Name | 7-bromo-3-[(dimethylamino)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one |
|---|---|
| PubChem CID | 25062249 |
| Molecular Formula | C14H20BrN7O |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 7-bromo-3-[(dimethylamino)methyl]-9-pentyl-6H-[1,2,4]triazolo[4,3-a]purin-5-one |
| SMILES | CCCCCn1c2nc(Br)[nH]c2c(=O)n2c(CN(C)C)nnc12 |
| InChI | InChI=1S/C14H20BrN7O/c1-4-5-6-7-21-11-10(16-13(15)17-11)12(23)22-9(8-20(2)3)18-19-14(21)22/h4-8H2,1-3H3,(H,16,17) |
| InChIKey | YJPRMYALVGEOEG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|