C11H15BrN6O — CID 143600172
N'-(8-bromo-2-oxo-3-pentyl-7H-purin-6-yl)methanimidamide (PubChem CID 143600172) has the molecular formula C11H15BrN6O and a molecular weight of 327.19 g/mol. Its IUPAC name is N'-(8-bromo-2-oxo-3-pentyl-7H-purin-6-yl)methanimidamide.
| Compound Name | N'-(8-bromo-2-oxo-3-pentyl-7H-purin-6-yl)methanimidamide |
|---|---|
| PubChem CID | 143600172 |
| Molecular Formula | C11H15BrN6O |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N'-(8-bromo-2-oxo-3-pentyl-7H-purin-6-yl)methanimidamide |
| SMILES | CCCCCn1c(=O)nc(/N=C/N)c2[nH]c(Br)nc21 |
| InChI | InChI=1S/C11H15BrN6O/c1-2-3-4-5-18-9-7(15-10(12)17-9)8(14-6-13)16-11(18)19/h6H,2-5H2,1H3,(H,15,17)(H2,13,14,16,19) |
| InChIKey | VDEUHOCNMKQGIE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|