C25H24BrN7O2 — CID 71153594
N-(8-bromo-3-butyl-2-oxo-7H-purin-6-yl)-2-[4-(3-cyanophenyl)phenoxy]-N'-methylethanimidamide (PubChem CID 71153594) has the molecular formula C25H24BrN7O2 and a molecular weight of 534.42 g/mol. Its IUPAC name is N-(8-bromo-3-butyl-2-oxo-7H-purin-6-yl)-2-[4-(3-cyanophenyl)phenoxy]-N'-methylethanimidamide.
| Compound Name | N-(8-bromo-3-butyl-2-oxo-7H-purin-6-yl)-2-[4-(3-cyanophenyl)phenoxy]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 71153594 |
| Molecular Formula | C25H24BrN7O2 |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N-(8-bromo-3-butyl-2-oxo-7H-purin-6-yl)-2-[4-(3-cyanophenyl)phenoxy]-N'-methylethanimidamide |
| SMILES | CCCCn1c(=O)nc(N/C(COc2ccc(-c3cccc(C#N)c3)cc2)=N/C)c2[nH]c(Br)nc21 |
| InChI | InChI=1S/C25H24BrN7O2/c1-3-4-12-33-23-21(30-24(26)32-23)22(31-25(33)34)29-20(28-2)15-35-19-10-8-17(9-11-19)18-7-5-6-16(13-18)14-27/h5-11,13H,3-4,12,15H2,1-2H3,(H,30,32)(H,28,29,31,34) |
| InChIKey | XWKRSFVYTPLJDG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|