C31H36N2O — CID 142247900
3-[4-[7-(3-hydroxy-5-methylanilino)-4-propyloct-7-en-4-yl]phenyl]benzonitrile (PubChem CID 142247900) has the molecular formula C31H36N2O and a molecular weight of 452.64 g/mol. Its IUPAC name is 3-[4-[7-(3-hydroxy-5-methylanilino)-4-propyloct-7-en-4-yl]phenyl]benzonitrile.
| Compound Name | 3-[4-[7-(3-hydroxy-5-methylanilino)-4-propyloct-7-en-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 142247900 |
| Molecular Formula | C31H36N2O |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 3-[4-[7-(3-hydroxy-5-methylanilino)-4-propyloct-7-en-4-yl]phenyl]benzonitrile |
| SMILES | C=C(CCC(CCC)(CCC)c1ccc(-c2cccc(C#N)c2)cc1)Nc1cc(C)cc(O)c1 |
| InChI | InChI=1S/C31H36N2O/c1-5-15-31(16-6-2,17-14-24(4)33-29-18-23(3)19-30(34)21-29)28-12-10-26(11-13-28)27-9-7-8-25(20-27)22-32/h7-13,18-21,33-34H,4-6,14-17H2,1-3H3 |
| InChIKey | JCFZWDHOMDAPPT-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |