C44H50N2 — CID 142248089
3-[4-(9-naphthalen-1-yl-5-propylnon-1-en-5-yl)phenyl]benzonitrile;N,3,5-trimethylaniline (PubChem CID 142248089) has the molecular formula C44H50N2 and a molecular weight of 606.90 g/mol. Its IUPAC name is 3-[4-(9-naphthalen-1-yl-5-propylnon-1-en-5-yl)phenyl]benzonitrile;N,3,5-trimethylaniline.
| Compound Name | 3-[4-(9-naphthalen-1-yl-5-propylnon-1-en-5-yl)phenyl]benzonitrile;N,3,5-trimethylaniline |
|---|---|
| PubChem CID | 142248089 |
| Molecular Formula | C44H50N2 |
| Molecular Weight | 606.90 g/mol |
| Exact Mass | 606.40 |
| IUPAC Name | 3-[4-(9-naphthalen-1-yl-5-propylnon-1-en-5-yl)phenyl]benzonitrile;N,3,5-trimethylaniline |
| SMILES | C=CCCC(CCC)(CCCCc1cccc2ccccc12)c1ccc(-c2cccc(C#N)c2)cc1.CNc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C35H37N.C9H13N/c1-3-5-24-35(23-4-2,25-9-8-14-31-16-11-15-30-13-6-7-18-34(30)31)33-21-19-29(20-22-33)32-17-10-12-28(26-32)27-36;1-7-4-8(2)6-9(5-7)10-3/h3,6-7,10-13,15-22,26H,1,4-5,8-9,14,23-25H2,2H3;4-6,10H,1-3H3 |
| InChIKey | WVKMOVUJAKCPKG-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.90 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|