C50H62N2 — CID 142248109
ethene;3-[4-[1-(4-phenyl-4-prop-1-ynylcyclohexyl)-4-propyloct-7-en-4-yl]phenyl]benzonitrile;N,3,5-trimethylaniline (PubChem CID 142248109) has the molecular formula C50H62N2 and a molecular weight of 691.06 g/mol. Its IUPAC name is ethene;3-[4-[1-(4-phenyl-4-prop-1-ynylcyclohexyl)-4-propyloct-7-en-4-yl]phenyl]benzonitrile;N,3,5-trimethylaniline.
| Compound Name | ethene;3-[4-[1-(4-phenyl-4-prop-1-ynylcyclohexyl)-4-propyloct-7-en-4-yl]phenyl]benzonitrile;N,3,5-trimethylaniline |
|---|---|
| PubChem CID | 142248109 |
| Molecular Formula | C50H62N2 |
| Molecular Weight | 691.06 g/mol |
| Exact Mass | 690.49 |
| IUPAC Name | ethene;3-[4-[1-(4-phenyl-4-prop-1-ynylcyclohexyl)-4-propyloct-7-en-4-yl]phenyl]benzonitrile;N,3,5-trimethylaniline |
| SMILES | C=C.C=CCCC(CCC)(CCCC1CCC(C#CC)(c2ccccc2)CC1)c1ccc(-c2cccc(C#N)c2)cc1.CNc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C39H45N.C9H13N.C2H4/c1-4-7-26-38(24-5-2,37-20-18-34(19-21-37)35-15-11-13-33(30-35)31-40)27-12-14-32-22-28-39(25-6-3,29-23-32)36-16-9-8-10-17-36;1-7-4-8(2)6-9(5-7)10-3;1-2/h4,8-11,13,15-21,30,32H,1,5,7,12,14,22-24,26-29H2,2-3H3;4-6,10H,1-3H3;1-2H2 |
| InChIKey | OWISUEILLYOCRH-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.06 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|