C21H26N2 — CID 142237675
3-[4-[3-[ethyl(propyl)amino]propyl]phenyl]benzonitrile (PubChem CID 142237675) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-[4-[3-[ethyl(propyl)amino]propyl]phenyl]benzonitrile.
| Compound Name | 3-[4-[3-[ethyl(propyl)amino]propyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 142237675 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-[4-[3-[ethyl(propyl)amino]propyl]phenyl]benzonitrile |
| SMILES | CCCN(CC)CCCc1ccc(-c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C21H26N2/c1-3-14-23(4-2)15-6-8-18-10-12-20(13-11-18)21-9-5-7-19(16-21)17-22/h5,7,9-13,16H,3-4,6,8,14-15H2,1-2H3 |
| InChIKey | UXUGCFCLEKATGB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |