C39H39FN2O5 — CID 25066266
phenyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate (PubChem CID 25066266) has the molecular formula C39H39FN2O5 and a molecular weight of 634.75 g/mol. Its IUPAC name is phenyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate.
| Compound Name | phenyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 25066266 |
| Molecular Formula | C39H39FN2O5 |
| Molecular Weight | 634.75 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | phenyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C39H39FN2O5/c1-26(2)37-36(39(46)41-30-14-8-4-9-15-30)35(27-12-6-3-7-13-27)38(28-18-20-29(40)21-19-28)42(37)23-22-31(43)24-32(44)25-34(45)47-33-16-10-5-11-17-33/h3-21,26,31-32,43-44H,22-25H2,1-2H3,(H,41,46)/t31-,32-/m1/s1 |
| InChIKey | UIWIAGOOSOIKKD-ROJLCIKYSA-N |
| XLogP | 7.83 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.75 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|