About CID 25068071
CID 25068071 (PubChem CID 25068071) has the molecular formula C12H10PSe
and a molecular weight of 264.15 g/mol.
Molecular Properties
| Compound Name | CID 25068071 |
| PubChem CID | 25068071 |
| Molecular Formula | C12H10PSe |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | — |
| SMILES | [Se]P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10PSe/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | PBVQBMKFYOFEHP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 25068071 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25068071?
The IUPAC name of CID 25068071 (CID 25068071) is not available.
What is the SMILES notation for CID 25068071?
The canonical SMILES for CID 25068071 is [Se]P(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 25068071?
The InChIKey is PBVQBMKFYOFEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10PSe/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of CID 25068071?
CID 25068071 has a molecular weight of 264.15 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25068071 is sourced from PubChem (CID 25068071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).