C22H24FN5O6S — CID 25069714
N-[[3-[3-fluoro-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide (PubChem CID 25069714) has the molecular formula C22H24FN5O6S and a molecular weight of 505.53 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 25069714 |
| Molecular Formula | C22H24FN5O6S |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CC(c2ccc(N3CCN(S(=O)(=O)c4cccc([N+](=O)[O-])c4)CC3)c(F)c2)=NO1 |
| InChI | InChI=1S/C22H24FN5O6S/c1-15(29)24-14-18-13-21(25-34-18)16-5-6-22(20(23)11-16)26-7-9-27(10-8-26)35(32,33)19-4-2-3-17(12-19)28(30)31/h2-6,11-12,18H,7-10,13-14H2,1H3,(H,24,29) |
| InChIKey | IFTGWOUOFPLMTI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|