C23H32FN7O2S — CID 46870935
N-[[3-[3-fluoro-4-[4-[[(1-methylpiperidin-4-ylidene)amino]carbamothioyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide (PubChem CID 46870935) has the molecular formula C23H32FN7O2S and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-[[(1-methylpiperidin-4-ylidene)amino]carbamothioyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-[[(1-methylpiperidin-4-ylidene)amino]carbamothioyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 46870935 |
| Molecular Formula | C23H32FN7O2S |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-[[(1-methylpiperidin-4-ylidene)amino]carbamothioyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CC(c2ccc(N3CCN(C(=S)NN=C4CCN(C)CC4)CC3)c(F)c2)=NO1 |
| InChI | InChI=1S/C23H32FN7O2S/c1-16(32)25-15-19-14-21(28-33-19)17-3-4-22(20(24)13-17)30-9-11-31(12-10-30)23(34)27-26-18-5-7-29(2)8-6-18/h3-4,13,19H,5-12,14-15H2,1-2H3,(H,25,32)(H,27,34) |
| InChIKey | DUXFPBTTZUXGLG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|