C25H39FN8O2 — CID 141281478
N-[[3-[3-fluoro-4-[4-[(E)-N'-[(2-propan-2-ylpiperidin-1-yl)amino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide (PubChem CID 141281478) has the molecular formula C25H39FN8O2 and a molecular weight of 502.64 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-[(E)-N'-[(2-propan-2-ylpiperidin-1-yl)amino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-[(E)-N'-[(2-propan-2-ylpiperidin-1-yl)amino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 141281478 |
| Molecular Formula | C25H39FN8O2 |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-[(E)-N'-[(2-propan-2-ylpiperidin-1-yl)amino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CC(c2ccc(N3CCN(/C(N)=N/NN4CCCCC4C(C)C)CC3)c(F)c2)=NO1 |
| InChI | InChI=1S/C25H39FN8O2/c1-17(2)23-6-4-5-9-34(23)31-29-25(27)33-12-10-32(11-13-33)24-8-7-19(14-21(24)26)22-15-20(36-30-22)16-28-18(3)35/h7-8,14,17,20,23,31H,4-6,9-13,15-16H2,1-3H3,(H2,27,29)(H,28,35) |
| InChIKey | GKBWDSASDHIRGC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|