C23H28FN7O2S — CID 46200508
N-[[3-[3-fluoro-4-[4-[(E)-N'-[(E)-(5-methylthiophen-2-yl)methylideneamino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide (PubChem CID 46200508) has the molecular formula C23H28FN7O2S and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-[(E)-N'-[(E)-(5-methylthiophen-2-yl)methylideneamino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-[(E)-N'-[(E)-(5-methylthiophen-2-yl)methylideneamino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 46200508 |
| Molecular Formula | C23H28FN7O2S |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-[(E)-N'-[(E)-(5-methylthiophen-2-yl)methylideneamino]carbamimidoyl]piperazin-1-yl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CC(c2ccc(N3CCN(/C(N)=N/N=C/c4ccc(C)s4)CC3)c(F)c2)=NO1 |
| InChI | InChI=1S/C23H28FN7O2S/c1-15-3-5-19(34-15)14-27-28-23(25)31-9-7-30(8-10-31)22-6-4-17(11-20(22)24)21-12-18(33-29-21)13-26-16(2)32/h3-6,11,14,18H,7-10,12-13H2,1-2H3,(H2,25,28)(H,26,32)/b27-14+ |
| InChIKey | YWXXBPWAGLNPIR-MZJWZYIUSA-N |
| XLogP | 2.30 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|