C23H32FN7O2 — CID 46200347
N-[[3-[4-[4-[(E)-N'-(cyclohexylideneamino)carbamimidoyl]piperazin-1-yl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide (PubChem CID 46200347) has the molecular formula C23H32FN7O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[[3-[4-[4-[(E)-N'-(cyclohexylideneamino)carbamimidoyl]piperazin-1-yl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[4-[(E)-N'-(cyclohexylideneamino)carbamimidoyl]piperazin-1-yl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 46200347 |
| Molecular Formula | C23H32FN7O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-[[3-[4-[4-[(E)-N'-(cyclohexylideneamino)carbamimidoyl]piperazin-1-yl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CC(c2ccc(N3CCN(/C(N)=N/N=C4CCCCC4)CC3)c(F)c2)=NO1 |
| InChI | InChI=1S/C23H32FN7O2/c1-16(32)26-15-19-14-21(29-33-19)17-7-8-22(20(24)13-17)30-9-11-31(12-10-30)23(25)28-27-18-5-3-2-4-6-18/h7-8,13,19H,2-6,9-12,14-15H2,1H3,(H2,25,28)(H,26,32) |
| InChIKey | IRIQLRMWRUAGFV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|