C29H34O5 — CID 25070167
[(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] 4-methoxybenzoate (PubChem CID 25070167) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] 4-methoxybenzoate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 25070167 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2C[C@]3(C)[C@@H](C(C)=O)CC[C@H]3[C@@H]3C=CC4=CC(=O)CC[C@@]4(C)[C@@H]32)cc1 |
| InChI | InChI=1S/C29H34O5/c1-17(30)23-11-12-24-22-10-7-19-15-20(31)13-14-28(19,2)26(22)25(16-29(23,24)3)34-27(32)18-5-8-21(33-4)9-6-18/h5-10,15,22-26H,11-14,16H2,1-4H3/t22-,23+,24-,25-,26-,28+,29+/m0/s1 |
| InChIKey | GHWBODZPMUUUIC-AIQZZOFESA-N |
| XLogP | 5.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |