C31H39NO7 — CID 25073936
[(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3,4,5-trimethoxyphenyl)carbamate (PubChem CID 25073936) has the molecular formula C31H39NO7 and a molecular weight of 537.65 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3,4,5-trimethoxyphenyl)carbamate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3,4,5-trimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 25073936 |
| Molecular Formula | C31H39NO7 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3,4,5-trimethoxyphenyl)carbamate |
| SMILES | COc1cc(NC(=O)O[C@H]2C[C@]3(C)[C@@H](C(C)=O)CC[C@H]3[C@@H]3C=CC4=CC(=O)CC[C@@]4(C)[C@@H]32)cc(OC)c1OC |
| InChI | InChI=1S/C31H39NO7/c1-17(33)22-9-10-23-21-8-7-18-13-20(34)11-12-30(18,2)27(21)26(16-31(22,23)3)39-29(35)32-19-14-24(36-4)28(38-6)25(15-19)37-5/h7-8,13-15,21-23,26-27H,9-12,16H2,1-6H3,(H,32,35)/t21-,22+,23-,26-,27-,30+,31+/m0/s1 |
| InChIKey | UCDHWCRTXOBDHG-MFKXXZFDSA-N |
| XLogP | 5.75 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |