C29H34N2O5 — CID 71064500
[(8S,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3-carbamoylphenyl)carbamate (PubChem CID 71064500) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is [(8S,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3-carbamoylphenyl)carbamate.
| Compound Name | [(8S,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3-carbamoylphenyl)carbamate |
|---|---|
| PubChem CID | 71064500 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [(8S,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-(3-carbamoylphenyl)carbamate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)CC[C@@]4(C)C3C(OC(=O)Nc3cccc(C(N)=O)c3)C[C@]12C |
| InChI | InChI=1S/C29H34N2O5/c1-16(32)22-9-10-23-21-8-7-18-14-20(33)11-12-28(18,2)25(21)24(15-29(22,23)3)36-27(35)31-19-6-4-5-17(13-19)26(30)34/h4-8,13-14,21-25H,9-12,15H2,1-3H3,(H2,30,34)(H,31,35)/t21-,22+,23-,24?,25?,28+,29+/m0/s1 |
| InChIKey | XFWIMZWSHQPPRS-GXMHDWOWSA-N |
| XLogP | 4.83 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |