C33H43NO6 — CID 71056026
[(8S,9R,10S,11S,13S,14S,17R)-17-acetyl-17-ethoxy-1,2,10,13-tetramethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-yl] N-(3-methoxyphenyl)carbamate (PubChem CID 71056026) has the molecular formula C33H43NO6 and a molecular weight of 549.71 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17R)-17-acetyl-17-ethoxy-1,2,10,13-tetramethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-yl] N-(3-methoxyphenyl)carbamate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17R)-17-acetyl-17-ethoxy-1,2,10,13-tetramethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-yl] N-(3-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 71056026 |
| Molecular Formula | C33H43NO6 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17R)-17-acetyl-17-ethoxy-1,2,10,13-tetramethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-yl] N-(3-methoxyphenyl)carbamate |
| SMILES | CCO[C@]1(C(C)=O)CC[C@H]2[C@@H]3C=CC4=CC(=O)C(C)C(C)[C@@]4(C)[C@@H]3[C@@H](OC(=O)Nc3cccc(OC)c3)C[C@@]21C |
| InChI | InChI=1S/C33H43NO6/c1-8-39-33(21(4)35)15-14-26-25-13-12-22-16-27(36)19(2)20(3)32(22,6)29(25)28(18-31(26,33)5)40-30(37)34-23-10-9-11-24(17-23)38-7/h9-13,16-17,19-20,25-26,28-29H,8,14-15,18H2,1-7H3,(H,34,37)/t19?,20?,25-,26-,28-,29-,31-,32+,33-/m0/s1 |
| InChIKey | LLKYOKDHJUSOPH-VNNYFDMQSA-N |
| XLogP | 6.39 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |