C31H41NO5 — CID 71064318
2-[(1S,2S,5S)-2-acetyl-5-[(2S,8aS)-6-oxo-8a-propyl-1,2,7,8-tetrahydronaphthalen-2-yl]-1-methylcyclopentyl]ethyl N-(4-methoxyphenyl)carbamate (PubChem CID 71064318) has the molecular formula C31H41NO5 and a molecular weight of 507.67 g/mol. Its IUPAC name is 2-[(1S,2S,5S)-2-acetyl-5-[(2S,8aS)-6-oxo-8a-propyl-1,2,7,8-tetrahydronaphthalen-2-yl]-1-methylcyclopentyl]ethyl N-(4-methoxyphenyl)carbamate.
| Compound Name | 2-[(1S,2S,5S)-2-acetyl-5-[(2S,8aS)-6-oxo-8a-propyl-1,2,7,8-tetrahydronaphthalen-2-yl]-1-methylcyclopentyl]ethyl N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 71064318 |
| Molecular Formula | C31H41NO5 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 2-[(1S,2S,5S)-2-acetyl-5-[(2S,8aS)-6-oxo-8a-propyl-1,2,7,8-tetrahydronaphthalen-2-yl]-1-methylcyclopentyl]ethyl N-(4-methoxyphenyl)carbamate |
| SMILES | CCC[C@@]12CCC(=O)C=C1C=C[C@@H]([C@@H]1CC[C@H](C(C)=O)[C@@]1(C)CCOC(=O)Nc1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C31H41NO5/c1-5-15-31-16-14-25(34)19-23(31)7-6-22(20-31)28-13-12-27(21(2)33)30(28,3)17-18-37-29(35)32-24-8-10-26(36-4)11-9-24/h6-11,19,22,27-28H,5,12-18,20H2,1-4H3,(H,32,35)/t22-,27-,28+,30-,31+/m1/s1 |
| InChIKey | CPZDIWRCPKDCRV-WHMJEIQFSA-N |
| XLogP | 6.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |