C14H19N2O5+ — CID 6929334
3,4,5,7-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium-7a-ylmethyl N-(4-methoxyphenyl)carbamate (PubChem CID 6929334) has the molecular formula C14H19N2O5+ and a molecular weight of 295.31 g/mol. Its IUPAC name is 3,4,5,7-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium-7a-ylmethyl N-(4-methoxyphenyl)carbamate.
| Compound Name | 3,4,5,7-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium-7a-ylmethyl N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 6929334 |
| Molecular Formula | C14H19N2O5+ |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3,4,5,7-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium-7a-ylmethyl N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OCC23COC[NH+]2COC3)cc1 |
| InChI | InChI=1S/C14H18N2O5/c1-18-12-4-2-11(3-5-12)15-13(17)21-8-14-6-19-9-16(14)10-20-7-14/h2-5H,6-10H2,1H3,(H,15,17)/p+1 |
| InChIKey | UGIZJSNRYJNRGA-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |