C18H18N2O3S — CID 25073118
3-(benzenesulfonyl)-9-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-ol (PubChem CID 25073118) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-9-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-ol.
| Compound Name | 3-(benzenesulfonyl)-9-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-ol |
|---|---|
| PubChem CID | 25073118 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-(benzenesulfonyl)-9-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-ol |
| SMILES | CC1NCCc2cn(S(=O)(=O)c3ccccc3)c3ccc(O)c1c23 |
| InChI | InChI=1S/C18H18N2O3S/c1-12-17-16(21)8-7-15-18(17)13(9-10-19-12)11-20(15)24(22,23)14-5-3-2-4-6-14/h2-8,11-12,19,21H,9-10H2,1H3 |
| InChIKey | WMHLDULSLHZDIB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|