C23H24F3N3O4S — CID 66786673
2-(benzenesulfonyl)-6-(pyrrolidin-3-ylmethyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene;2,2,2-trifluoroacetic acid (PubChem CID 66786673) has the molecular formula C23H24F3N3O4S and a molecular weight of 495.52 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-6-(pyrrolidin-3-ylmethyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(benzenesulfonyl)-6-(pyrrolidin-3-ylmethyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66786673 |
| Molecular Formula | C23H24F3N3O4S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-(benzenesulfonyl)-6-(pyrrolidin-3-ylmethyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(c1ccccc1)n1cc2c3c(cccc31)CN(CC1CCNC1)C2 |
| InChI | InChI=1S/C21H23N3O2S.C2HF3O2/c25-27(26,19-6-2-1-3-7-19)24-15-18-14-23(12-16-9-10-22-11-16)13-17-5-4-8-20(24)21(17)18;3-2(4,5)1(6)7/h1-8,15-16,22H,9-14H2;(H,6,7) |
| InChIKey | AIMZCRVTZVZGGZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |