C24H25F6N3O6S — CID 87150629
2-[2-(benzenesulfonyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-yl]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87150629) has the molecular formula C24H25F6N3O6S and a molecular weight of 597.53 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-yl]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[2-(benzenesulfonyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-yl]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87150629 |
| Molecular Formula | C24H25F6N3O6S |
| Molecular Weight | 597.53 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-2,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-yl]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCN1Cc2cccc3c2c(cn3S(=O)(=O)c2ccccc2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23N3O2S.2C2HF3O2/c1-21(2)11-12-22-13-16-7-6-10-19-20(16)17(14-22)15-23(19)26(24,25)18-8-4-3-5-9-18;2*3-2(4,5)1(6)7/h3-10,15H,11-14H2,1-2H3;2*(H,6,7) |
| InChIKey | MOEJGRMINFWAQH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |