C21H20F2N2O3S — CID 2507600
1-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]naphthalen-2-ol (PubChem CID 2507600) has the molecular formula C21H20F2N2O3S and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]naphthalen-2-ol.
| Compound Name | 1-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 2507600 |
| Molecular Formula | C21H20F2N2O3S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]naphthalen-2-ol |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(Cc2c(O)ccc3ccccc23)CC1 |
| InChI | InChI=1S/C21H20F2N2O3S/c22-18-6-3-7-19(23)21(18)29(27,28)25-12-10-24(11-13-25)14-17-16-5-2-1-4-15(16)8-9-20(17)26/h1-9,26H,10-14H2 |
| InChIKey | PLJQDTKWUCMTRX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|