C20H30O5 — CID 25077176
(1S,4S,5R,9R,10R,11S,13R,14R,16S)-10,16-dihydroxy-5,9,13-trimethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-5-carboxylic acid (PubChem CID 25077176) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1S,4S,5R,9R,10R,11S,13R,14R,16S)-10,16-dihydroxy-5,9,13-trimethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-5-carboxylic acid.
| Compound Name | (1S,4S,5R,9R,10R,11S,13R,14R,16S)-10,16-dihydroxy-5,9,13-trimethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 25077176 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,4S,5R,9R,10R,11S,13R,14R,16S)-10,16-dihydroxy-5,9,13-trimethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-5-carboxylic acid |
| SMILES | C[C@@]12O[C@H]3C[C@H]1C[C@@]1(CC[C@@H]4[C@](C)(C(=O)O)CCC[C@@]4(C)[C@]31O)[C@@H]2O |
| InChI | InChI=1S/C20H30O5/c1-16(15(22)23)6-4-7-17(2)12(16)5-8-19-10-11-9-13(20(17,19)24)25-18(11,3)14(19)21/h11-14,21,24H,4-10H2,1-3H3,(H,22,23)/t11-,12+,13-,14+,16+,17+,18+,19-,20+/m0/s1 |
| InChIKey | SGRXKDSYPFTIOV-UQCVVEJQSA-N |
| XLogP | 2.34 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |