C21H26N3O4S+ — CID 2508396
methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-[(2,3,4-trimethoxyphenyl)methyl]azanium (PubChem CID 2508396) has the molecular formula C21H26N3O4S+ and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-[(2,3,4-trimethoxyphenyl)methyl]azanium.
| Compound Name | methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-[(2,3,4-trimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 2508396 |
| Molecular Formula | C21H26N3O4S+ |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-[(2,3,4-trimethoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH+](C)Cc2nc3sc4c(c3c(=O)[nH]2)CCC4)c(OC)c1OC |
| InChI | InChI=1S/C21H25N3O4S/c1-24(10-12-8-9-14(26-2)19(28-4)18(12)27-3)11-16-22-20(25)17-13-6-5-7-15(13)29-21(17)23-16/h8-9H,5-7,10-11H2,1-4H3,(H,22,23,25)/p+1 |
| InChIKey | AEMULVCIGZXEBK-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |