C16H19ClN4 — CID 25095032
6-(4-chlorophenyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine (PubChem CID 25095032) has the molecular formula C16H19ClN4 and a molecular weight of 302.81 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine.
| Compound Name | 6-(4-chlorophenyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 25095032 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 6-(4-chlorophenyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
| SMILES | CNC1CCN(c2cc(N)nc(-c3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C16H19ClN4/c1-19-13-6-7-21(10-13)14-8-15(20-16(18)9-14)11-2-4-12(17)5-3-11/h2-5,8-9,13,19H,6-7,10H2,1H3,(H2,18,20) |
| InChIKey | GRHQMCXNRSDAPW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |