C21H19IN4O3S — CID 25095204
1-[3-(4-iodophenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]-3-isoquinolin-5-ylurea (PubChem CID 25095204) has the molecular formula C21H19IN4O3S and a molecular weight of 534.38 g/mol. Its IUPAC name is 1-[3-(4-iodophenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[3-(4-iodophenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 25095204 |
| Molecular Formula | C21H19IN4O3S |
| Molecular Weight | 534.38 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | 1-[3-(4-iodophenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(Nc1cccc2cnccc12)NC1C2CN(S(=O)(=O)c3ccc(I)cc3)CC21 |
| InChI | InChI=1S/C21H19IN4O3S/c22-14-4-6-15(7-5-14)30(28,29)26-11-17-18(12-26)20(17)25-21(27)24-19-3-1-2-13-10-23-9-8-16(13)19/h1-10,17-18,20H,11-12H2,(H2,24,25,27) |
| InChIKey | AXFLOUKMYJYCLC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|