C22H19F3N4O — CID 25097760
1-isoquinolin-5-yl-3-[3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-yl]urea (PubChem CID 25097760) has the molecular formula C22H19F3N4O and a molecular weight of 412.42 g/mol. Its IUPAC name is 1-isoquinolin-5-yl-3-[3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-yl]urea.
| Compound Name | 1-isoquinolin-5-yl-3-[3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-yl]urea |
|---|---|
| PubChem CID | 25097760 |
| Molecular Formula | C22H19F3N4O |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-isoquinolin-5-yl-3-[3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-yl]urea |
| SMILES | O=C(Nc1cccc2cnccc12)NC1C2CN(c3ccc(C(F)(F)F)cc3)CC21 |
| InChI | InChI=1S/C22H19F3N4O/c23-22(24,25)14-4-6-15(7-5-14)29-11-17-18(12-29)20(17)28-21(30)27-19-3-1-2-13-10-26-9-8-16(13)19/h1-10,17-18,20H,11-12H2,(H2,27,28,30) |
| InChIKey | UWHDWHFEHQGDBK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |