C35H39F3N4O6 — CID 25096358
3-[4-[1-[2-[6-cyano-1-[(3-methylphenyl)methyl]indazol-3-yl]-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxycyclohexa-1,5-dien-1-yl]propanoic acid (PubChem CID 25096358) has the molecular formula C35H39F3N4O6 and a molecular weight of 668.71 g/mol. Its IUPAC name is 3-[4-[1-[2-[6-cyano-1-[(3-methylphenyl)methyl]indazol-3-yl]-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxycyclohexa-1,5-dien-1-yl]propanoic acid.
| Compound Name | 3-[4-[1-[2-[6-cyano-1-[(3-methylphenyl)methyl]indazol-3-yl]-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxycyclohexa-1,5-dien-1-yl]propanoic acid |
|---|---|
| PubChem CID | 25096358 |
| Molecular Formula | C35H39F3N4O6 |
| Molecular Weight | 668.71 g/mol |
| Exact Mass | 668.28 |
| IUPAC Name | 3-[4-[1-[2-[6-cyano-1-[(3-methylphenyl)methyl]indazol-3-yl]-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxycyclohexa-1,5-dien-1-yl]propanoic acid |
| SMILES | COC1=CC(CCC(=O)O)=CC(OC)C1OC1CCN(CC(O)(c2nn(Cc3cccc(C)c3)c3cc(C#N)ccc23)C(F)(F)F)CC1 |
| InChI | InChI=1S/C35H39F3N4O6/c1-22-5-4-6-25(15-22)20-42-28-16-24(19-39)7-9-27(28)33(40-42)34(45,35(36,37)38)21-41-13-11-26(12-14-41)48-32-29(46-2)17-23(8-10-31(43)44)18-30(32)47-3/h4-7,9,15-18,26,29,32,45H,8,10-14,20-21H2,1-3H3,(H,43,44) |
| InChIKey | HNBSULNIBPVPSI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.71 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |