C14H23N3O3 — CID 25098020
N-hexyl-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-2-carboxamide (PubChem CID 25098020) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-hexyl-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-2-carboxamide.
| Compound Name | N-hexyl-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25098020 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-hexyl-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-2-carboxamide |
| SMILES | CCCCCCNC(=O)N1C(=O)C2CCCCN2C1=O |
| InChI | InChI=1S/C14H23N3O3/c1-2-3-4-6-9-15-13(19)17-12(18)11-8-5-7-10-16(11)14(17)20/h11H,2-10H2,1H3,(H,15,19) |
| InChIKey | XBDUFAYMUGUKCO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|