C19H17NO3S — CID 25098358
N-[3-(hydroxymethyl)phenyl]-4-phenylbenzenesulfonamide (PubChem CID 25098358) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)phenyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[3-(hydroxymethyl)phenyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 25098358 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[3-(hydroxymethyl)phenyl]-4-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CO)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NO3S/c21-14-15-5-4-8-18(13-15)20-24(22,23)19-11-9-17(10-12-19)16-6-2-1-3-7-16/h1-13,20-21H,14H2 |
| InChIKey | QISRVSILAPJTBL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |