C30H33FN4O6 — CID 25102874
ethyl (E)-3-[(2R)-2-[[4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-8-yl]prop-2-enoate (PubChem CID 25102874) has the molecular formula C30H33FN4O6 and a molecular weight of 564.61 g/mol. Its IUPAC name is ethyl (E)-3-[(2R)-2-[[4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-8-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R)-2-[[4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-8-yl]prop-2-enoate |
|---|---|
| PubChem CID | 25102874 |
| Molecular Formula | C30H33FN4O6 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | ethyl (E)-3-[(2R)-2-[[4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-8-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(F)c2c3c1ccc(=O)n3[C@H](CN1CCC(NCc3cc4c(cn3)OCCO4)CC1)CO2 |
| InChI | InChI=1S/C30H33FN4O6/c1-2-38-28(37)6-3-19-13-24(31)30-29-23(19)4-5-27(36)35(29)22(18-41-30)17-34-9-7-20(8-10-34)32-15-21-14-25-26(16-33-21)40-12-11-39-25/h3-6,13-14,16,20,22,32H,2,7-12,15,17-18H2,1H3/b6-3+/t22-/m1/s1 |
| InChIKey | FKARFSLSPWCUQG-XRRIUQSZSA-N |
| XLogP | 3.07 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|