C30H34FN5O6 — CID 68713445
(E)-but-2-enedioic acid;(2R)-6-fluoro-2-[[4-(5,6,7,8-tetrahydrocinnolin-3-ylmethylamino)piperidin-1-yl]methyl]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-12-one (PubChem CID 68713445) has the molecular formula C30H34FN5O6 and a molecular weight of 579.63 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2R)-6-fluoro-2-[[4-(5,6,7,8-tetrahydrocinnolin-3-ylmethylamino)piperidin-1-yl]methyl]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-12-one.
| Compound Name | (E)-but-2-enedioic acid;(2R)-6-fluoro-2-[[4-(5,6,7,8-tetrahydrocinnolin-3-ylmethylamino)piperidin-1-yl]methyl]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-12-one |
|---|---|
| PubChem CID | 68713445 |
| Molecular Formula | C30H34FN5O6 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | (E)-but-2-enedioic acid;(2R)-6-fluoro-2-[[4-(5,6,7,8-tetrahydrocinnolin-3-ylmethylamino)piperidin-1-yl]methyl]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-12-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=c1ccc2ccc(F)c3c2n1[C@H](CN1CCC(NCc2cc4c(nn2)CCCC4)CC1)CO3 |
| InChI | InChI=1S/C26H30FN5O2.C4H4O4/c27-22-7-5-17-6-8-24(33)32-21(16-34-26(22)25(17)32)15-31-11-9-19(10-12-31)28-14-20-13-18-3-1-2-4-23(18)30-29-20;5-3(6)1-2-4(7)8/h5-8,13,19,21,28H,1-4,9-12,14-16H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t21-;/m1./s1 |
| InChIKey | HZJKZCJUURMPHJ-CMABEYDLSA-N |
| XLogP | 2.71 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|