C27H29FN6O7S — CID 68715843
(E)-but-2-enedioic acid;(2R)-2-[[4-(6,7-dihydro-[1,4]dioxino[2,3-c]pyridazin-3-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-4-thia-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one (PubChem CID 68715843) has the molecular formula C27H29FN6O7S and a molecular weight of 600.63 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2R)-2-[[4-(6,7-dihydro-[1,4]dioxino[2,3-c]pyridazin-3-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-4-thia-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one.
| Compound Name | (E)-but-2-enedioic acid;(2R)-2-[[4-(6,7-dihydro-[1,4]dioxino[2,3-c]pyridazin-3-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-4-thia-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one |
|---|---|
| PubChem CID | 68715843 |
| Molecular Formula | C27H29FN6O7S |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | (E)-but-2-enedioic acid;(2R)-2-[[4-(6,7-dihydro-[1,4]dioxino[2,3-c]pyridazin-3-ylmethylamino)piperidin-1-yl]methyl]-6-fluoro-4-thia-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=c1ccc2ncc(F)c3c2n1[C@H](CN1CCC(NCc2cc4c(nn2)OCCO4)CC1)CS3 |
| InChI | InChI=1S/C23H25FN6O3S.C4H4O4/c24-17-11-26-18-1-2-20(31)30-16(13-34-22(17)21(18)30)12-29-5-3-14(4-6-29)25-10-15-9-19-23(28-27-15)33-8-7-32-19;5-3(6)1-2-4(7)8/h1-2,9,11,14,16,25H,3-8,10,12-13H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-;/m1./s1 |
| InChIKey | AUTNHUGQSVXXKE-RWKFXIDCSA-N |
| XLogP | 1.71 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|